![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | A_convective_kinematic_trajectory_technique_for_Amazonia_2000_Saulo_Freitas_Artaxo_2000JD900217.pdf | 2014-06-23 14:42 | 1.3M | |
| A_convective_mechanism_for_trace_gases_and_aerosols_transport_Saulo_Freitas_Artaxo_JGR_2000.pdf | 2014-06-23 14:42 | 3.6M | |
| A convective mechanism for trace gases and aerosols transport Saulo Freitas Artaxo JGR 2000.pdf | 2020-08-18 22:14 | 3.6M | |
| Amazonia LBA Revista Galileu - Artaxo Globo Ciencia_2000.pdf | 2020-08-18 22:15 | 9.4M | |
| Amazonia_LBA_Revista_Galileu_-_Artaxo_Globo_Ciencia_2000.pdf | 2014-06-23 14:42 | 9.4M | |
| Atmospheric_volatile_organic_compounds_(VOC)_at_a_remote_tropical_forest_site_in_central_Amazonia_Artaxo_2000.pdf | 2014-06-23 14:42 | 513K | |
| Atmospheric volatile organic compounds (VOC) at a remote tropical forest site in central Amazonia Artaxo 2000.pdf | 2020-08-18 22:15 | 513K | |
| Carbonaceous_aerosol_characterization_in_the_Amazon_basin_Brazil_novel_dicarboxylic_acids_and_related_compounds_Artaxo_AE_2000.pdf | 2014-06-23 14:42 | 372K | |
| Carbonaceous aerosol characterization in the Amazon basin, Brazil novel dicarboxylic acids and related compounds Artaxo AE 2000.pdf | 2020-08-18 22:15 | 372K | |
| Chemical_composition_of_aerosol_particles_from_direct_emissions_of_vegetation_fires_in_the_Amazon_Yamasoe_Artaxo_AE_2000.pdf | 2014-06-23 14:42 | 321K | |
| Chemical composition of aerosol particles from direct emissions of vegetation fires in the Amazon Yamasoe Artaxo AE 2000.pdf | 2020-08-18 22:15 | 321K | |
| Large_scale_mercury_and_trace_element_measurements_Artaxo_2000_Atmospheric-Environment.pdf | 2014-06-23 14:42 | 487K | |
| Large scale mercury and trace element measurements Artaxo_2000_Atmospheric-Environment.pdf | 2020-08-18 22:15 | 487K | |
| The_chemistry_and_role_of_cloud_condensation_nuclei_in_the_Amazon_basin_Artaxo_JAS_2000.pdf | 2014-06-23 14:42 | 151K | |
| The chemistry and role of cloud condensation nuclei in the Amazon basin Artaxo JAS 2000.pdf | 2020-08-18 22:15 | 151K | |
|
|---|