![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Artaxo__Cloud_Condensation_Nuclei_in_Amazonia_Marine_GRL_Greg_Roberts.pdf | 2014-06-23 14:42 | 3.1M | |
| Chemical_composition_of_rainwater_and_anthropogenic_influences_in_the_Piracicaba_River_Basin_Southeast_Brazil_Lara_Artaxo_AE_2001.pdf | 2014-06-23 14:42 | 191K | |
| Chemical composition of rainwater and anthropogenic influences in the Piracicaba River Basin, Southeast Brazil Lara Artaxo AE 2001.pdf | 2020-08-18 22:12 | 191K | |
| Cloud Condensation Nuclei in Amazonia Artaxo GRL_Greg_Roberts.pdf | 2020-08-18 22:12 | 3.1M | |
| Cloud_Condensation_Nuclei_in_the_Amazon_Basin_Marine_Conditions_over_a_Continent_Greg_Roberts_Artaxo_2001.pdf | 2014-06-23 14:42 | 480K | |
| Observed_reductions_of_total_solar_irradiance_by_biomass-burning_Brazilian_Amazon_Zambian_Savanna_Joel_Artaxo_GRL_2001.pdf | 2014-06-23 14:42 | 206K | |
| Observed reductions of total solar irradiance by biomass-burning Brazilian Amazon Zambian Savanna Joel Artaxo GRL 2001.pdf | 2020-08-18 22:12 | 206K | |
| Organic_Aerosols_Amazon-Basin_Carboxilic_acids_Magda_Claes_Artaxo JMS_2001.pdf | 2020-08-18 22:13 | 6.2M | |
| Organic_Aerosols_Amazon-Basin_Carboxilic_acids_Magda_Claes_Artaxo_JMS_2001.pdf | 2014-06-23 14:42 | 6.2M | |
| Sahara Dust Formenti_Saharan_Dust_in Brazil_Suriname Artaxo Formenti JGR 2001.pdf | 2020-08-18 22:13 | 7.2M | |
| Sahara_Dust_Formenti_Saharan_Dust_in_Brazil_Suriname_Artaxo_Formenti_JGR_2001.pdf | 2014-06-23 14:42 | 7.2M | |
| Saharan dust in Brazil and Suriname during the LBA Formenti_et_al-2001-JGR.pdf | 2020-08-18 22:14 | 2.0M | |
| The_chemistry_and_role_of_cloud_condensation_nuclei_in_the_Amazon_basin_Artaxo_AE_2001.pdf | 2014-06-23 14:42 | 151K | |
| The chemistry and role of cloud condensation nuclei in the Amazon basin Artaxo AE 2001.pdf | 2020-08-18 22:13 | 151K | |
| Transpoprt Biomass Burning Paper_LBA-CLAIRE_GRL_High_Altitude_Plume GRL 2001.pdf | 2020-08-18 22:13 | 1.0M | |
| Transpoprt_Biomass_Burning_Paper_LBA-CLAIRE_GRL_High_Altitude_Plume_GRL_2001.pdf | 2014-06-23 14:42 | 1.0M | |
| Transport_of_Biomass_Burning_Smoke_to_the_Upper_Troposphere_by_Deep_Convection_in_the_Equatorial_Region_Artaxo_GRL_2001.pdf | 2014-06-23 14:42 | 512K | |
| Wintertime_and_summertime_Sao_Paulo_aerosol_source_Castanho_2001_Atmospheric-Environment.pdf | 2014-06-23 14:42 | 389K | |
| Wintertime and summertime Sao Paulo aerosol source Castanho_2001_Atmospheric-Environment.pdf | 2020-08-18 22:14 | 389K | |
|
|---|