![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | AMS_primary_biological_particle_markers_indication_for_low_abundance_of_primary_biological_material_in_the_submicron_aerosol_of_Amazonia_Johanes_Schneider_ACPD_June_2011.pdf | 2014-06-23 14:42 | 2.0M | |
| Aerosol_properties_in-canopy_gradients_turbulent_fluxes_and_VOC_Luciana_Rizzo_Artaxo_AE_2011.pdf | 2014-06-23 14:42 | 884K | |
| Aerosol properties, in-canopy gradients, turbulent fluxes and VOC Luciana Rizzo Artaxo AE 2011.pdf | 2020-08-18 01:07 | 884K | |
| Alves_2011_Toxicology-Letters.pdf | 2014-06-23 14:42 | 80K | |
| Biogeography_in_the_air_fungal_diversity_over_land_and_oceans_Frohlich_BGD_July_2011.pdf | 2014-06-23 14:42 | 583K | |
| Biogeography in the air fungal diversity over land and oceans Frohlich BGD July 2011.pdf | 2020-08-18 01:07 | 583K | |
| Contrasting Organic Aerosol Particles from Boreal and Tropical Forests AMAZE-08 Coherent Vibrational Spectroscopy Geiger ACPD 2011.pdf | 2020-08-18 01:07 | 1.8M | |
| Contrasting_Organic_Aerosol_Particles_from_Boreal_and_Tropical_Forests_During_AMAZE-08_Using_Coherent_Vibrational_Spectroscopy_Artaxo_Geiger_ACPD_2011.pdf | 2014-06-23 14:42 | 1.8M | |
| EUCAARI_General_overview_European_Integrated_project_on_Aerosol_Cloud_climate_and_Air_Quality_ACP_2011.pdf | 2014-06-23 14:42 | 3.5M | |
| Ecosystem-scale_compensation_points_of_formic_and_acetic_acid_in_Jardine_et_al._2011b.pdf | 2014-06-23 14:42 | 1.4M | |
| Ecosystem-scale compensation points of formic and acetic acid in Central Amazonia Kolby Jardine Artaxo bg 2011.pdf | 2020-08-18 01:07 | 1.5M | |
| Effects of Heavy Industrial Pollution on Cubatao envhper 2011.pdf | 2020-08-18 01:07 | 743K | |
| Evaluation_of_the_carbon_content_of_aerosols_from_the_burning_of_biomass_in_Brazil_acp-11-4425-2011.pdf | 2014-06-23 14:42 | 2.1M | |
| Evaluation of the carbon content of aerosols from the burning of biomass in Brazil acp-11-4425-2011.pdf | 2020-08-18 01:08 | 2.1M | |
| Fog_and_Cloud_Induced_Aerosol_Modification_Observed_by_AERONET_Tom_Eck_Set_2011.pdf | 2014-06-23 14:42 | 6.1M | |
| Fog and Cloud Induced Aerosol Modification Observed by AERONET Tom Eck Set 2011.pdf | 2020-08-18 01:08 | 6.1M | |
| Further_evidence_for_significant_smoke_transport_from_Africa_to_Amazonia_Hoger_Baars_Artaxo_GRL_2011.pdf | 2014-06-23 14:42 | 324K | |
| Further_evidence_for_significant_smoke_transport_from_Africa_to_Amazonia_Holger_GRL_Oct_2011.pdf | 2014-06-23 14:42 | 323K | |
| Further evidence for significant smoke transport from Africa to Amazonia Hoger Baars Artaxo GRL 2011.pdf | 2020-08-18 01:08 | 324K | |
| General_overview_EUCAARI__European_Integrated_project_on_Aerosol_Cloud_acp-11-13061-2011.pdf | 2014-06-23 14:42 | 3.5M | |
| General overview EUCAARI European Integrated project on Aerosol Cloud acp-11-13061-2011.pdf | 2020-08-18 01:08 | 3.5M | |
| Genotoxicity_and_composition_of_particulate_matter_from_biomass_burning_in_the_eastern_Brazilian_Amazon_region__NIlmara_Sandra_Hacon_2011.pdf | 2014-06-23 14:42 | 612K | |
| Genotoxicity and composition of particulate matter from biomass burning in the eastern Brazilian Amazon region NIlmara Sandra Hacon 2011.pdf | 2020-08-18 01:08 | 612K | |
| Impact_of_the_Manaus_urban_plume_on_trace_gas_mixing_ratios_near_the_surface_of_Amazon_Basin_Dec_2011.pdf | 2014-06-23 14:42 | 11M | |
| Impact of the Manaus urban plume on trace gas mixing ratios near the surface of Amazon Basin Dec 2011.pdf | 2020-08-18 01:09 | 11M | |
| Mass-spectrometric identification of primary biological particle markers application to pristine Amazonia Schneider acp 2011.pdf | 2020-08-18 01:10 | 2.1M | |
| Mestrado Melina Paixao Propriedades Oticas Amazonia 2011 .pdf | 2020-08-18 01:10 | 5.1M | |
| On_molecular_chirality_within_naturally_occurring_secondary_organic_aerosols_from_Central_Amazon_basin_Geiger_Artaxo_PCCP_2011.pdf | 2014-06-23 14:42 | 2.5M | |
| On molecular chirality within naturally occurring secondary organic aerosols from Central Amazon basin Geiger Artaxo PCCP 2011.pdf | 2020-08-18 01:10 | 2.5M | |
| Remote_sensing_the_vertical_profile_of_cloud_droplet_effective_radius_thermodynamic_phase_and_temperature_ACP_Set_2011.pdf | 2014-06-23 14:42 | 4.0M | |
| Remote sensing the vertical profile of cloud droplet effective radius, thermodynamic phase, and temperature ACP Set 2011.pdf | 2020-08-18 01:11 | 4.0M | |
| SOURCES AND PROPERTIES OF AMAZONIAN Aerosols Scot Martin Artaxo Review Geophysics 2011.pdf | 2020-08-18 01:11 | 2.6M | |
| SOURCES_AND_PROPERTIES_OF_AMAZONIAN_Aerosols_Scot_Martin_Artaxo_Review_Geophysics_2011.pdf | 2014-06-23 14:42 | 2.6M | |
| Sources_of_carbonaceous_aerosol_in_the_Amazon_basin_Stefania_Gilardoni_Artaxo_ACP_April_2011.pdf | 2014-06-23 14:42 | 1.5M | |
| Sources of carbonaceous aerosol in the Amazon basin Stefania Gilardoni Artaxo ACP April 2011.pdf | 2020-08-18 01:11 | 1.5M | |
| Spectral_dependence_of_aerosol_light_absorption_over_Amazonia_Luciana_Rizzo_2011_acp-11-8899-2011.pdf | 2014-06-23 14:42 | 1.7M | |
| Spectral dependence of aerosol light absorption over Amazonia Luciana Rizzo 2011 acp-11-8899-2011.pdf | 2020-08-18 01:11 | 1.7M | |
| Stereochemical_transfer_to_atmospheric_aerosol_particles_accompanying_the_oxidation_of_biogenic_volatile_organic_compounds.pdf | 2014-06-23 14:42 | 270K | |
| Stereochemical transfer to atmospheric aerosol particles accompanying the oxidation of biogenic volatile organic compounds.pdf | 2020-08-18 01:11 | 270K | |
| The_human_dimension_of_fire_regimes_on_Earth_Bowman_Biogeography_Set_2011.pdf | 2014-06-23 14:42 | 1.0M | |
| The_variability_of_urban_aerosol_size_distributions_and_optical_properties_in_Sao_Paulo_New_particle_formation_ACPD_Nov_2011.pdf | 2014-06-23 14:42 | 1.4M | |
| The human dimension of fire regimes on Earth Bowman Biogeography Set 2011.pdf | 2020-08-18 01:11 | 1.0M | |
| Tools_for_Improving_Air_Quality_Management_A_Review_of_Source_Apportiontment_and_Application_in_Developing_Countries_2011.pdf | 2014-06-23 14:42 | 1.8M | |
| Tools for Improving Air Quality Management A Review of Source Apportiontment and Application in Developing Countries 2011.pdf | 2020-08-18 01:11 | 1.8M | |
| UNEP Integrated Assessment WMO SDM 2011.pdf | 2020-08-18 01:11 | 2.6M | |
| UNEP_Integrated_Assessment_WMO_SDM_2011.pdf | 2014-06-23 14:42 | 2.6M | |
| Within-canopy_sesquiterpene_ozonolysis_in_Amazonia_Kolby_Jardine_Artaxo_JGR_Out_2011.pdf | 2014-06-23 14:42 | 922K | |
| Within-canopy sesquiterpene ozonolysis in Amazonia Kolby Jardine Artaxo JGR Out 2011.pdf | 2020-08-18 01:12 | 922K | |
|
|---|